Back to All Chapters
Organic Chemistry

GOC and POC

Browse 120 questions on GOC and POC. Click on any question to view the detailed answer and explanation.

Who proposed the 'Vital Force Theory' stating organic compounds couldn't be synthesized in the lab?

Introduction

Which was the first organic compound synthesized from an inorganic source, and by whom?

Introduction

What is the hybridization and shape of the carbon atom in methane (CH4​)?

Tetravalence of Carbon

What is the hybridization and shape of the carbon atoms in ethene (C2​H4​)?

Tetravalence of Carbon

What is the hybridization and shape of the carbon atoms in ethyne (C2​H2​)?

Tetravalence of Carbon

How does s-character in hybrid orbitals affect electronegativity?

Bonding

What is the characteristic feature of π bond formation regarding orbital orientation?

Bonding

In wedge-and-dash representation, what does the solid wedge indicate?

Structural Representation

In wedge-and-dash representation, what does the dashed wedge indicate?

Structural Representation

What are Alicyclic compounds?

Classification

What are Heterocyclic compounds?

Classification

Define a Homologous Series.

Classification

What is the order of priority for functional groups: Alcohol, Ketone, Aldehyde, Carboxylic Acid?

Nomenclature

What is the IUPAC suffix for the −CHO group?

Nomenclature

What is the IUPAC prefix for the −OR group?

Nomenclature

How are substituents numbered in a benzene ring if there are three or more?

Nomenclature

What is Metamerism?

Isomerism

Pentane, Isopentane, and Neopentane are examples of which type of isomerism?

Isomerism

Propan-1-ol and Propan-2-ol are examples of which type of isomerism?

Isomerism

What is Heterolytic Cleavage?

Reaction Mechanism

What species is formed when a carbon atom possesses a sextet of electrons and a positive charge?

Reaction Mechanism

What is the order of stability of alkyl carbocations?

Reaction Mechanism

What is the hybridization and shape of the positively charged carbon in a carbocation?

Reaction Mechanism

What is Homolytic Cleavage?

Reaction Mechanism

What is the order of stability of alkyl free radicals?

Reaction Mechanism

Define a Nucleophile.

Reagents

Define an Electrophile.

Reagents

What is the Inductive Effect?

Electronic Effects

Give examples of electron-withdrawing groups (-I effect).

Electronic Effects

Give examples of electron-donating groups (+I effect).

Electronic Effects

What is Resonance Energy?

Electronic Effects

What characterizes the +R (Positive Resonance) Effect?

Electronic Effects

What characterizes the -R (Negative Resonance) Effect?

Electronic Effects

What is the Electromeric Effect?

Electronic Effects

What is Hyperconjugation?

Electronic Effects

Why is the tert-butyl cation (CH3)3C+(CH_3)_3C^+more stable than the ethyl cation?

Electronic Effects

What is Sublimation used for?

Purification

What is the principle of Crystallization?

Purification

When is Fractional Distillation used?

Purification

What is Distillation under reduced pressure used for?

Purification

What is Steam Distillation used for?

Purification

What is the principle of Chromatography?

Purification

In Thin Layer Chromatography (TLC), what is the retardation factor (Rf​)?

Chromatography

What is the purpose of Lassaigne's Test?

Qualitative Analysis

In Lassaigne's test, what is the compound fused with?

Qualitative Analysis

What is the test for Nitrogen in Lassaigne's extract?

Qualitative Analysis

What is the formula of the Prussian Blue complex?

Qualitative Analysis

How is Sulphur detected using Sodium Nitroprusside?

Qualitative Analysis

If both N and S are present, what color is obtained in Lassaigne's test?

Qualitative Analysis

How are Halogens detected in Lassaigne's extract?

Qualitative Analysis

What indicates the presence of Phosphorus?

Qualitative Analysis

How are Carbon and Hydrogen estimated?

Quantitative Analysis

Which substance absorbs water in C & H estimation?

Quantitative Analysis

Which substance absorbs CO2​ in C & H estimation?

Quantitative Analysis

What is the Dumas Method used for?

Quantitative Analysis

What is the Kjeldahl's Method used for?

Quantitative Analysis

For which compounds is Kjeldahl's method not applicable?

Quantitative Analysis

What is the Carius Method used for?

Quantitative Analysis

In Sulphur estimation, what is the precipitate weighed?

Quantitative Analysis

How is Oxygen usually estimated?

Quantitative Analysis

Who proposed the 'Vital Force Theory', and who disproved it by synthesizing Urea?

Introduction

Write the reaction for the first synthesis of an organic compound from an inorganic one.

Introduction

What is the hybridization and geometry of Carbon in Methane ( CH4CH_4 )?

Bonding & Shapes

What is the hybridization and geometry of Carbon in Ethene ( C2H4C_2H_4 )?

Bonding & Shapes

What is the hybridization and geometry of Carbon in Ethyne ( C2H2C_2H_2 )?

Bonding & Shapes

Compare the bond length and strength of sp3sp^3 , sp2sp^2 , and spsp hybridized carbon bonds.

Bonding & Shapes

How does the percentage of s-character affect electronegativity?

Bonding & Shapes

What type of orbital overlap forms a π\pi (pi) bond?

Bonding & Shapes

What are Alicyclic compounds?

Classification

What are Heterocyclic compounds?

Classification

Give an example of a Non-benzenoid aromatic compound mentioned in the text.

Classification

Identify the parent chain length for: CH3CH(CH3)CH2CH(CH2CH3)CH2CH2CH3CH_3-CH(CH_3)-CH_2-CH(CH_2CH_3)-CH_2-CH_2-CH_3 .

Nomenclature

What is the correct priority order for these functional groups: OH,CHO,COOH,COR-OH, -CHO, -COOH, -COR ?

Nomenclature

What is the IUPAC name for CH3COCH3CH_3COCH_3 ?

Nomenclature

What is the IUPAC prefix and suffix for the Nitrile group ( CN-CN )?

Nomenclature

What is the structure of the Neopentyl group?

Nomenclature

Define Metamerism with an example.

Isomerism

What type of isomerism is shown by Propan-1-ol and Propan-2-ol?

Isomerism

What type of isomerism is shown by Ethanol ( C2H5OHC_2H_5OH ) and Dimethyl ether ( CH3OCH3CH_3OCH_3 )?

Isomerism

What is Heterolytic Cleavage?

Reaction Mechanism

What is the shape and hybridization of the carbon in a methyl carbocation ( C+H3\overset{+}{C}H_3 )?

Reaction Mechanism

Arrange alkyl carbocations in increasing order of stability.

Reaction Mechanism

What is Homolytic Cleavage and what does it generate?

Reaction Mechanism

Arrange alkyl free radicals in increasing order of stability.

Reaction Mechanism

Define a Nucleophile.

Reaction Mechanism

Define an Electrophile.

Reaction Mechanism

What is the Inductive Effect (I-effect)?

Electronic Effects

Which effect explains the acidity order: Cl3CCOOH>Cl2CHCOOH>ClCH2COOHCl_3CCOOH > Cl_2CHCOOH > ClCH_2COOH ?

Electronic Effects

What is the Resonance Effect (R-effect)?

Electronic Effects

Give examples of groups showing +R effect (electron donating via resonance).

Electronic Effects

Give examples of groups showing -R effect (electron withdrawing via resonance).

Electronic Effects

What is the Electromeric Effect (E-effect)?

Electronic Effects

What is Hyperconjugation?

Electronic Effects

Why is the ethyl cation ( CH3CH2+CH_3CH_2^+ ) more stable than the methyl cation?

Electronic Effects

What is the principle of Sublimation?

Purification

What is the principle of Crystallization?

Purification

When is Fractional Distillation used?

Purification

What is Distillation under Reduced Pressure used for?

Purification

What is Steam Distillation used for?

Purification

What is the principle of Differential Extraction?

Purification

Define Adsorption Chromatography and give two types.

Chromatography

Define Partition Chromatography and give an example.

Chromatography

What is the formula for the Retardation Factor ( RfR_f )?

Chromatography

Why is organic compound fused with Sodium metal (Lassaigne’s Test)?

Qualitative Analysis

What is the confirmatory test for Nitrogen?

Qualitative Analysis

What is the confirmatory test for Sulphur using Lead Acetate?

Qualitative Analysis

What is the confirmatory test for Sulphur using Sodium Nitroprusside?

Qualitative Analysis

What happens if both N and S are present in Lassaigne's test?

Qualitative Analysis

How do you detect Chlorine in Lassaigne's extract?

Qualitative Analysis

How do you detect Bromine in Lassaigne's extract?

Qualitative Analysis

How do you detect Iodine in Lassaigne's extract?

Qualitative Analysis

How is Phosphorus detected?

Qualitative Analysis

How are Carbon and Hydrogen estimated?

Quantitative Analysis

What is the principle of Dumas Method for N estimation?

Quantitative Analysis

What is the principle of Kjeldahl's Method for N estimation?

Quantitative Analysis

Where is Kjeldahl's method not applicable?

Quantitative Analysis

What is the Carius Method used for?

Quantitative Analysis

In Sulphur estimation, what is the precipitate formed and weighed?

Quantitative Analysis

How is Oxygen estimated directly?

Quantitative Analysis

What is the formula for % Nitrogen in Dumas Method?

Quantitative Analysis