Questions/JEE Main 2026/Identify A, B, and C...
21 Jan - MorningJEE Main 2026

Identify A, B, and C in this Lead ( PbPb ) reaction sequence: 1. PbCl2+K2CrO4A(Yellow)+KClPbCl_2 + K_2CrO_4 \rightarrow \mathbf{A} (\text{Yellow}) + KCl 2. A+NaOH(excess)B(Soluble)\mathbf{A} + NaOH (\text{excess}) \rightarrow \mathbf{B} (\text{Soluble}) 3. PbSO4+CH3COONH4C(Soluble)+(NH4)2SO4PbSO_4 + CH_3COONH_4 \rightarrow \mathbf{C} (\text{Soluble}) + (NH_4)_2SO_4

Expert Answer

A: PbCrO4PbCrO_4 (Lead Chromate) B: Na2[Pb(OH)4]Na_2[Pb(OH)_4] (Sodium plumbite) C: Pb(CH3COO)2Pb(CH_3COO)_2 (Lead Acetate) Pro-Tip: PbCrO4PbCrO_4 dissolves in excess NaOH because Lead is amphoteric.

Master this topic with Flashcards

Use our Spaced Repetition flashcards to memorize 21 Jan - Morning and ace your exams.

Start Practicing Now