Back to All Chapters
Organic Chemistry

Stereochemistry

Browse 99 questions on Stereochemistry. Click on any question to view the detailed answer and explanation.

Does the presence of a Center of Symmetry (COS) or Plane of Symmetry (POS) guarantee optical inactivity?

Chirality & Symmetry

True or False: A molecule must have a chiral carbon to be chiral.

Chirality & Symmetry

Under what condition is an allene ( C=C=CC=C=C ) chiral?

Chirality & Symmetry

What prevents rotation in chiral Biphenyls (Atropisomerism)?

Chirality & Symmetry

Why are simple chiral amines (like N(CH3)(Et)(Pr)N(CH_3)(Et)(Pr) ) not optically active at room temperature?

Chirality & Symmetry

What is a Pseudo-asymmetric center?

Chirality & Symmetry

How do you identify Homotopic protons?

Chirality & Symmetry

How do you identify Enantiotopic protons?

Chirality & Symmetry

Is the molecule CH3CHDOHCH_3-CHD-OH chiral?

Chirality & Symmetry

How do you assign priority between CH(CH3)2-CH(CH_3)_2 andCH=CH2-CH=CH_2using CIP rules?

Configuration & Nomenclature

If the lowest priority group (4) is on the horizontal line in a Fischer Projection, how is R/S assigned?

Configuration & Nomenclature

Assign E/Z to F(Cl)C=C(Br)IF(Cl)C=C(Br)I .

Configuration & Nomenclature

How is Syn/Anti assigned in Aldoximes ( RCH=NOHR-CH=N-OH )?

Configuration & Nomenclature

How do you distinguish Erythro and Threo in Fischer Projections?

Configuration & Nomenclature

What is the formula for Specific Rotation [α][\alpha] ?

Optical Activity & Isomer Types

A mixture has 75% (+) and 25% (-). What is the enantiomeric excess (ee)?

Optical Activity & Isomer Types

Formula for total stereoisomers with nn chiral centers and no symmetry?

Optical Activity & Isomer Types

Can a Meso compound be resolved into enantiomers?

Optical Activity & Isomer Types

Why is a racemic mixture optically inactive?

Optical Activity & Isomer Types

What distinguishes Epimers from Diastereomers?

Optical Activity & Isomer Types

What is the principle behind chemical resolution?

Optical Activity & Isomer Types

What are Anomers?

Optical Activity & Isomer Types

What is Mutarotation?

Optical Activity & Isomer Types

If pure R is +50+50^\circ and sample is10-10^\circ, find composition.

Optical Activity & Isomer Types

What is the difference between Conformation and Configuration?

Optical Activity & Isomer Types

Can (CH3)2C=C(Cl)H(\text{CH}_3)_2\text{C}=\text{C}(\text{Cl})\text{H} show GI?

Geometrical Isomerism

Which has a higher dipole moment: Cis or Trans?

Geometrical Isomerism

Why do Trans isomers usually have higher Melting Points?

Geometrical Isomerism

How do you treat Cumulenes with an odd number of double bonds?

Geometrical Isomerism

Which ethane conformation is most stable and why?

Conformational Isomerism

Why is Ethylene Glycol more stable in Gauche than Anti?

Conformational Isomerism

Why is Cyclohexane Chair more stable than Boat?

Conformational Isomerism

What happens to bonds during Ring Flipping?

Conformational Isomerism

Why is axial-Methylcyclohexane unstable?

Conformational Isomerism

Which Decalin isomer cannot ring flip?

Conformational Isomerism

Which cycloalkane has the highest angle strain?

Conformational Isomerism

Energy barrier for Cyclohexane chair flip?

Conformational Isomerism

Stereochemical outcome of SN2S_N2 ?

Reaction Stereochem (Sub/Elim)

Does SN1S_N1 give 100% Racemization?

Reaction Stereochem (Sub/Elim)

Stereochemical requirement for E2 elimination?

Reaction Stereochem (Sub/Elim)

Cis-2-butene + Br2/CCl4Br_2/CCl_4 yields?

Reaction Stereochem (Add/Ox/Red)

Trans-2-butene + Br2/CCl4Br_2/CCl_4 yields?

Reaction Stereochem (Add/Ox/Red)

What is the Stereochemistry of OsO4OsO_4 or cold KMnO4KMnO_4 addition across a C=C?

Reaction Stereochem (Add/Ox/Red)

Stereochemistry of Hydroboration-Oxidation?

Reaction Stereochem (Add/Ox/Red)

Stereochemistry of Catalytic Hydrogenation ( H2H_2 /Pd)?

Reaction Stereochem (Add/Ox/Red)

Birch Reduction (Na/ NH3NH_3 ) of internal alkyne yields?

Reaction Stereochem (Add/Ox/Red)

Is Diels-Alder stereospecific?

Reaction Stereochem (Add/Ox/Red)

Stereochemistry of Epoxidation (mCPBA)?

Reaction Stereochem (Add/Ox/Red)

What is Bredt's Rule regarding chirality?

Reaction Stereochem (Add/Ox/Red)

Difference: Stereospecific vs Stereoselective?

Reaction Stereochem (Add/Ox/Red)

What is an Axis of Symmetry ( CnC_n )?

Chirality & Symmetry

Are Spiranes (two rings sharing one atom) chiral?

Chirality & Symmetry

What is a Prochiral carbon?

Chirality & Symmetry

Why are quaternary ammonium salts (e.g., [N(R1)(R2)(R3)(R4)]+[N(R_1)(R_2)(R_3)(R_4)]^+ ) optically active?

Chirality & Symmetry

What is the Alternating Axis of Symmetry ( SnS_n )?

Chirality & Symmetry

Is Adamantane chiral?

Chirality & Symmetry

How does D/L Nomenclature differ from R/S?

Configuration & Nomenclature

In CIP priority, how are isotopes ranked (e.g., H, D, T)?

Configuration & Nomenclature

What is the priority of a Lone Pair in CIP rules?

Configuration & Nomenclature

What is the "Golden Rule" for switching two groups in a Fischer Projection?

Configuration & Nomenclature

How do you assign R/S to a chiral center in a ring?

Configuration & Nomenclature

Configuration of natural Amino Acids?

Configuration & Nomenclature

Does temperature affect Specific Rotation?

Optical Activity & Isomer Types

What is Kinetic Resolution?

Optical Activity & Isomer Types

How many stereoisomers does Tartaric Acid have?

Optical Activity & Isomer Types

What is Diastereomeric Excess (de)?

Optical Activity & Isomer Types

Can a molecule be chiral without chiral centers?

Optical Activity & Isomer Types

What is Invertomer?

Optical Activity & Isomer Types

Does 1,2-dimethylcyclopropane show GI?

Geometrical Isomerism

Formula for GI in polyenes ( RCH=CHCH=CHRR-CH=CH-CH=CH-R ) with identical ends?

Geometrical Isomerism

Compare Boiling Points of Cis vs Trans 1,2-dichloroethene.

Geometrical Isomerism

Can Cyclooctene show Cis-Trans isomerism?

Geometrical Isomerism

Does N=NN=N bond show Geometrical Isomerism?

Geometrical Isomerism

Is stability always Trans > Cis?

Geometrical Isomerism

Draw the potential energy profile of n-Butane. Which is the global minimum?

Conformational Isomerism

Compare stability of 1,4-trans vs 1,4-cis dimethylcyclohexane.

Conformational Isomerism

Compare stability of 1,3-trans vs 1,3-cis dimethylcyclohexane.

Conformational Isomerism

What is a Locking Group in cyclohexane?

Conformational Isomerism

What is the Anomeric Effect?

Conformational Isomerism

Is the Twist-Boat conformation chiral?

Conformational Isomerism

Heat of Combustion: Cis vs Trans isomers?

Conformational Isomerism

What is the SNi mechanism?

Reaction Stereochem (Sub/Elim)

What is NGP (Neighboring Group Participation)?

Reaction Stereochem (Sub/Elim)

Stereochemistry of Pyrolytic Elimination (Ei)?

Reaction Stereochem (Sub/Elim)

Stereochemistry of E1cb reaction?

Reaction Stereochem (Sub/Elim)

Stereochemistry of Dehalogenation with Zn dust?

Reaction Stereochem (Sub/Elim)

How does steric hindrance affect SN2 stereochemistry?

Reaction Stereochem (Sub/Elim)

Stereochemistry of Hofmann Elimination?

Reaction Stereochem (Sub/Elim)

Stereochemistry of Carbene ( :CH2:CH_2 ) addition?

Reaction Stereochem (Add/Ox/Red)

Stereochemistry of Halohydrin Formation ( X2/H2OX_2/H_2O )?

Reaction Stereochem (Add/Ox/Red)

Stereochemistry of Simmons-Smith Reaction ( ZnCu,CH2I2Zn-Cu, CH_2I_2 )?

Reaction Stereochem (Add/Ox/Red)

Stereochemistry of Lindlar's Catalyst Hydrogenation?

Reaction Stereochem (Add/Ox/Red)

Beckmann Rearrangement Stereochemistry?

Reaction Stereochem (Add/Ox/Red)

Baeyer-Villiger Oxidation Stereochemistry?

Reaction Stereochem (Add/Ox/Red)

Stereochemistry of HBr + Peroxide (Kharasch effect)?

Reaction Stereochem (Add/Ox/Red)

Woodward-Hoffmann Rule for Electrocyclic reactions?

Reaction Stereochem (Add/Ox/Red)

Stereochemistry of Cope Elimination?

Reaction Stereochem (Add/Ox/Red)

Hydroboration of hindered cyclic alkenes?

Reaction Stereochem (Add/Ox/Red)

Stereochemistry of Ozonolysis?

Reaction Stereochem (Add/Ox/Red)